Target Relevance

Molecular Definition

Canonical SMILES C[C@@H](c1ccc2NC(=O)Sc2c1)c3ccn(n3)c4ccc(CCC(C)(C)O)cn4
Formula C22H24N4O2S
Molecular Weight 408.52 da
Stereocenters 1/1