Molecular Definition

Canonical SMILES CC(C)Oc1c(NC(=O)c2csc3C(=O)NC=Nc23)cccc1C(=O)N4CCN(C)CC4
Formula C22H25N5O4S
Molecular Weight 455.53 da
Stereocenters 0/0