Target Relevance

Molecular Definition

Canonical SMILES Clc1cccc2N3CC\C(=C/N4CCCCC4)\C3=NC(=O)c12
Formula C17H18ClN3O
Molecular Weight 315.80 da
Stereocenters 0/0