Molecular Definition

Canonical SMILES COc1cc(ccc1NC(=O)c2csc3C(=O)NC=Nc23)C(=O)NCCCN4CCN(C)CC4
Formula C23H28N6O4S
Molecular Weight 484.57 da
Stereocenters 0/0