Molecular Definition

Canonical SMILES CCc1cc(Nc2ncc(F)c(n2)c3cnc4cccnn34)cc(OCCN5CCC(O)CC5)c1
Formula C25H28FN7O2
Molecular Weight 477.53 da
Stereocenters 0/0