Target Relevance

Molecular Definition

Canonical SMILES CN(C)\C=C\1/CCN2C1=NC(=O)c3c(Cl)cccc23
Formula C14H14ClN3O
Molecular Weight 275.73 da
Stereocenters 0/0