Target Relevance

Molecular Definition

Canonical SMILES CCC(CC)\C=C\1/CCN2C1=NC(=O)c3c(Cl)cccc23
Formula C17H19ClN2O
Molecular Weight 302.80 da
Stereocenters 0/0