Molecular Definition

Canonical SMILES CN(C)c1cc(ccc1NC(=O)c2csc3C(=O)NC=Nc23)C(=O)N4CCN(C)CC4
Formula C21H24N6O3S
Molecular Weight 440.52 da
Stereocenters 0/0