Molecular Definition

Canonical SMILES CCN(C)c1cc(ccc1NC(=O)c2csc3C(=O)NC=Nc23)C(=O)N4CCN(C)CC4
Formula C22H26N6O3S
Molecular Weight 454.55 da
Stereocenters 0/0