Molecular Definition

Canonical SMILES CCOc1cc(\C=C\2/Sc3ccccc3C2=O)cc(Br)c1OCC(=O)O
Formula C19H15BrO5S
Molecular Weight 435.29 da
Stereocenters 0/0