Molecular Definition

Canonical SMILES Brc1ccc(s1)C(=O)N[C@H]2CCC[C@H](C2)n3c(nc4ccccc34)c5ccccn5
Formula C23H21BrN4OS
Molecular Weight 481.41 da
Stereocenters 2/2