Molecular Definition

Canonical SMILES Cc1noc(CN2N=C3C=CC(=CN3C2=O)c4ccc(OC(F)(F)F)cc4)n1
Formula C17H12F3N5O3
Molecular Weight 391.30 da
Stereocenters 0/0