Molecular Definition

Canonical SMILES NC(=O)c1ccc2c(c1)nc(c3ccccn3)n2[C@@H]4CCC[C@@H](C4)NC(=O)c5ccc(Br)s5
Formula C24H22BrN5O2S
Molecular Weight 524.43 da
Stereocenters 2/2