Molecular Definition

Canonical SMILES Brc1ccc(s1)C(=O)N[C@H]2CCC[C@H](C2)n3c(nc4cc(ccc34)C(=O)NC5CC5)c6ccccn6
Formula C27H26BrN5O2S
Molecular Weight 564.50 da
Stereocenters 2/2