Molecular Definition

Canonical SMILES CNC(=O)c1ccc2c(c1)nc(c3nccs3)n2[C@@H]4CCC[C@@H](C4)NC(=O)c5ccc(Br)s5
Formula C23H22BrN5O2S2
Molecular Weight 544.49 da
Stereocenters 2/2