Molecular Definition

Canonical SMILES CC(C)c1c(NC(=O)Nc2ccc(c(Cl)c2)n3cc(CN)cn3)cnc4cc(Cl)nn14
Formula C20H20Cl2N8O
Molecular Weight 459.33 da
Stereocenters 0/0