Molecular Definition

Canonical SMILES CSCC[C@@H]1NC(=O)[C@H](Cc2ccccc2)NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](CSSC[C@@H]3NC(=O)[C@@H]4CSSC[C@H](NC(=O)[C@H](Cc5c[nH]c6ccccc56)NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc7cnc[nH]7)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CO)NC(=O)[C@H](CSSC[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCNC(=N)N)NC1=O)C(=O)N[C@@H](Cc8ccc(cc8)C(=O)O)C(=O)N9CCC[C@H]9C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)N4)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(=O)N)NC(=O)[C@@H]%10CCCN%10C(=O)[C@H](CCCNC(=N)N)NC3=O)C(C)C)[C@@H](C)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](Cc%11ccc(O)cc%11)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](Cc%12ccccc%12)C(=O)N)NC(=O)[C@@H](N)CC(=O)O
Formula C180H269N53O47S7
Molecular Weight 4151.84 da
Stereocenters 34/34