Molecular Definition

Canonical SMILES OC(=O)c1ccc(OC[C@H]2CC[C@H](N2)C(=O)N3CCC[C@H]3C#N)c(Cl)c1
Formula C18H20ClN3O4
Molecular Weight 377.82 da
Stereocenters 3/3