Target Relevance

Molecular Definition

Canonical SMILES CCc1cc(cc(C)c1OC[C@@H](O)CNC(=O)CO)c2noc(n2)c3cc(C)nc(CN4CCCC4)c3
Formula C27H35N5O5
Molecular Weight 509.60 da
Stereocenters 1/1