Molecular Definition

Canonical SMILES COc1cc(C)c(CNCC(NC(=O)c2cc(C)on2)c3ccccc3)cc1C
Formula C23H27N3O3
Molecular Weight 393.48 da
Stereocenters 0/1