Molecular Definition

Canonical SMILES CC1(C)Cc2cccc(OCCNC(=O)\C=C\c3cccnc3)c2O1
Formula C20H22N2O3
Molecular Weight 338.40 da
Stereocenters 0/0