Target Relevance

Molecular Definition

Canonical SMILES CCOc1cc(C)c(CNCC(NC(=O)c2cc(C)on2)c3ccccc3)cc1C
Formula C24H29N3O3
Molecular Weight 407.51 da
Stereocenters 0/1