Target Relevance

Molecular Definition

Canonical SMILES COc1cc(C)c(CNCC(NC(=O)c2cc(C)on2)c3ccc(CCCC(=O)N)cc3)cc1C
Formula C27H34N4O4
Molecular Weight 478.58 da
Stereocenters 0/1