Target Relevance

Molecular Definition

Canonical SMILES Cc1onc(c1)C(=O)NC(CNCc2cc(C)c(OCC(F)(F)F)cc2C)c3ccccc3
Formula C24H26F3N3O3
Molecular Weight 461.48 da
Stereocenters 0/1