Molecular Definition

Canonical SMILES O=C(NC1CCN(CC1)S(=O)(=O)CC2CCNCC2)c3ccc4NC(=O)Cc4c3
Formula C20H28N4O4S
Molecular Weight 420.53 da
Stereocenters 0/0