Molecular Definition

Canonical SMILES CCOC(=O)CC[C@@H](NC(=O)[C@H](C)NC(=O)CNC(=O)c1cc2ccc(cc2[nH]1)c3ccccc3)C(=O)OCC
Formula C29H34N4O7
Molecular Weight 550.60 da
Stereocenters 2/2