Target Relevance

Molecular Definition

Canonical SMILES COc1cc(C)c(CNCC(NC(=O)c2cc(C)on2)c3ccc(cc3)C#CCO)cc1C
Formula C26H29N3O4
Molecular Weight 447.53 da
Stereocenters 0/1