Molecular Definition

Canonical SMILES NC1CCN(CC1)S(=O)(=O)N2[C@@H]3CC[C@H]2C[C@H](C3)NC(=O)c4cc5CC(=O)Nc5cc4F
Formula C21H28FN5O4S
Molecular Weight 465.54 da
Stereocenters 3/3