Molecular Definition

Canonical SMILES Cc1onc(c1)C(=O)NC(CNCc2cc(C)c(OCc3ccncc3)cc2C)c4ccccc4
Formula C28H30N4O3
Molecular Weight 470.56 da
Stereocenters 0/1