Target Relevance

Molecular Definition

Canonical SMILES COc1cc(C)c(CNCC(NC(=O)c2cc(on2)C3CC3)c4ccccc4)cc1C
Formula C25H29N3O3
Molecular Weight 419.52 da
Stereocenters 0/1