Molecular Definition

Canonical SMILES CC[C@H](C)[C@@H]1NC(=O)[C@@H]2CSSC[C@@H]3NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(=O)N)NC(=O)[C@@H]4CCCN4C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CSSC[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](N)Cc5c[nH]c6ccccc56)C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](Cc7ccccc7)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)N2)NC(=O)[C@H](CSSC[C@H](NC(=O)[C@H](Cc8c[nH]c9ccccc89)NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc%10cnc[nH]%10)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CO)NC3=O)[C@@H](C)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](Cc%11ccc(O)cc%11)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](Cc%12ccccc%12)C(=O)N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(=O)N)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H]%13CCCN%13C1=O)C(C)C
Formula C187H281N55O46S7
Molecular Weight 4260.03 da
Stereocenters 36/36