Target Relevance

Molecular Definition

Canonical SMILES COc1cc(C)c(CNCC(NC(=O)c2cc(C)on2)c3ccc(F)cc3)cc1C
Formula C23H26FN3O3
Molecular Weight 411.47 da
Stereocenters 0/1