Target Relevance

Molecular Definition

Canonical SMILES CCc1cc(cc(C)c1OC[C@@H](O)CNC(=O)CO)c2noc(n2)c3ccc(C)c(CN(C)CC(C)C)c3
Formula C29H40N4O5
Molecular Weight 524.65 da
Stereocenters 1/1