Molecular Definition

Canonical SMILES Cc1c(sc2N=CNC(=O)c12)C(=O)Nc3ccccc3CC(=O)O
Formula C16H13N3O4S
Molecular Weight 343.36 da
Stereocenters 0/0