Molecular Definition

Canonical SMILES COc1ccc(CC[C@@H](NC(=O)[C@@H]2CCCCN2C(=O)[C@@H](C3CCCCC3)c4cc(OC)c(OC)c(OC)c4)c5cccc(OCC(=O)O)c5)cc1OC
Formula C42H54N2O10
Molecular Weight 746.89 da
Stereocenters 3/3