Molecular Definition

Canonical SMILES COc1c(NC(=O)C(=O)c2ccc(OCCN3CCC(CC3)C(=O)O)c4ccccc24)cc(cc1NS(=O)(=O)C)C(C)(C)C
Formula C32H39N3O8S
Molecular Weight 625.73 da
Stereocenters 0/0