Molecular Definition

Canonical SMILES CCCS(=O)(=O)Nc1cc(cc(NC(=O)C(=O)c2ccc(OCCN3CCOCC3)c4ccccc24)c1OC)C(C)(C)C
Formula C32H41N3O7S
Molecular Weight 611.75 da
Stereocenters 0/0