Molecular Definition

Canonical SMILES COc1c(NC(=O)C(=O)c2ccc(OCC[N+]3(C)CCOCC3)c4ccccc24)cc(cc1NS(=O)(=O)C)C(C)(C)C.[O-]C(=O)C(F)(F)F
Formula C33H40F3N3O9S
Molecular Weight 711.75 da
Stereocenters 0/1