Target Relevance

Molecular Definition

Canonical SMILES CCN\C(=N/S(=O)(=O)c1cccc(N)c1)\N2CC3(CCCC3)C=N2
Formula C16H23N5O2S
Molecular Weight 349.45 da
Stereocenters 0/0