Molecular Definition

Canonical SMILES CCN(CCN(C)C)C(=O)CNCc1cc(CNC(=O)C(F)(F)F)ccn1
Formula C17H26F3N5O2
Molecular Weight 389.42 da
Stereocenters 0/0