Molecular Definition

Canonical SMILES COc1c(NC(=O)C(=O)c2ccc(OCCN3CCOCC3)c4ccccc24)cc(cc1NS(=O)(=O)CCCNC(CO)(CO)CO)C(C)(C)C
Formula C36H50N4O10S
Molecular Weight 730.87 da
Stereocenters 0/0