Molecular Definition

Canonical SMILES C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)c2ccc(Br)cc2)C(=O)N[C@@H](Cc3ccc(O)cc3)C(=O)N[C@@H](CCCC[N+](C)(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCCNC(=O)CCCC[C@@H]4SC[C@@H]5NC(=O)N[C@H]45)C(=O)N
Formula C61H86BrN12O14S
Molecular Weight 1323.38 da
Stereocenters 10/11