Molecular Definition

Canonical SMILES C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)c2ccc(Br)cc2)C(=O)N[C@@H](Cc3ccc(O)cc3)C(=O)N[C@@H](CCCC[N+](C)(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCCNC(=S)Nc4ccc(C5=C6C=CC(=O)C=C6Oc7cc(O)ccc57)c(c4)C(=O)O)C(=O)N
Formula C72H83BrN11O17S
Molecular Weight 1486.46 da
Stereocenters 7/8