Molecular Definition

Canonical SMILES O=C1NC=Nc2c1ccnc2n3cc(CCN4CCC(Cc5cccnc5)CC4)cn3
Formula C23H25N7O
Molecular Weight 415.49 da
Stereocenters 0/0