Molecular Definition

Canonical SMILES CN1C(=O)N(C)c2cc(Oc3cccc(OCc4ccccc4)c3)c(NS(=O)(=O)c5cn(C)c(C)n5)cc12
Formula C27H27N5O5S
Molecular Weight 533.60 da
Stereocenters 0/0