Molecular Definition

Canonical SMILES O=C1NC=Nc2c(CNCc3ccccc3)nccc12
Formula C15H14N4O
Molecular Weight 266.30 da
Stereocenters 0/0