Molecular Definition

Canonical SMILES Fc1ccc(CC2CCN(CCc3cnn(c3)c4nccc5C(=O)NC=Nc45)CC2)cc1
Formula C24H25FN6O
Molecular Weight 432.49 da
Stereocenters 0/0