Molecular Definition

Canonical SMILES CN(CCCc1cnn(c1)c2nccc3C(=O)NC=Nc23)Cc4ccc(cc4)C#N
Formula C22H21N7O
Molecular Weight 399.45 da
Stereocenters 0/0