Molecular Definition

Canonical SMILES COc1ccc(cc1OC)S(=O)(=O)Nc2cc3N(C)C(=O)N(C)c3cc2Oc4cccc(OCCCCN(C)C)c4
Formula C29H36N4O7S
Molecular Weight 584.68 da
Stereocenters 0/0