Molecular Definition

Canonical SMILES Fc1cccc(c1)c2c[nH]c(n2)[C@H]3Cc4c([nH]c5ccccc45)[C@H](N3)C6CCOCC6
Formula C25H25FN4O
Molecular Weight 416.49 da
Stereocenters 2/2